PMR Logo

Member Login   

9,12,15-Octadecatrienoic acid

      Basic compound information

StdInChIKeyDTOSIQBPPRVQHS-IUQGRGSQSA-N
Compound FormulaC18H30O2
ISU Metabolite annotationC18:3(9,12,15) FA, ME
Retention Time774
SMILESCC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O
Theoretical Mass278.4

      ChemSpider search

      Pathways containing 9,12,15-Octadecatrienoic acid

       Experimental data on species/experiment(s)