PMR Logo

Member Login   

Silane, trimethyl(phenylmethoxy)-

      Basic compound information

Retention Index1155.7
StdInChIKeyAOKMFXQCRBQJOP-UHFFFAOYSA-N
Metabolite annotationSilane, trimethyl(phenylmethoxy)-
Compound FormulaC10H16OSi
Retention Time (min)302.4
SMILESO([Si](C)(C)C)Cc1ccccc1

      ChemSpider search

      Pathways containing Silane, trimethyl(phenylmethoxy)-

       Experimental data on species/experiment(s)