PMR Logo

Member Login   

Valine, DL- (2TMS)

      Basic compound information

Retention Index0
StdInChIKeyKZSNJWFQEVHDMF-SCSAIBSYSA-N
Metabolite annotationValine, DL- (2TMS)
ActionTMS:HI
CAS640-68-6|15984-93-7|7364-44-5|7480-78-6|516-06-3|72-18-4
Compound FormulaC5H11NO2
Retention Time (min)320.39
SMILESCC(C)[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing Valine, DL- (2TMS)

       Experimental data on species/experiment(s)