PMR Logo

Member Login   

Isoleucine (2TMS)

      Basic compound information

Retention Index1284.6
StdInChIKeyAGPKZVBTJJNPAG-WHFBIAKZSA-N
Metabolite annotationIsoleucine (2TMS)
CAS206184-16-9|7483-92-3|7004-09-3|73-32-5|15985-01-0|319-78-8|443-79-8|1509-35-9|1509-34-8
Compound FormulaC6H13NO2
Mass131.09463
Retention Time (min)344.86
SMILESCC[C@H](C)[C@H](N)C(O)=O

      ChemSpider search

      Pathways containing Isoleucine (2TMS)

       Experimental data on species/experiment(s)