PMR Logo

Member Login   

Threonine, DL- (3TMS)

      Basic compound information

Retention Index1372.2
StdInChIKeyAYFVYJQAPQTCCC-STHAYSLISA-N
Metabolite annotationThreonine, DL- (3TMS)
CAS64569-35-3|7536-82-5|80-68-2|72-19-5|24830-94-2|632-20-2|144-98-9|28954-12-3|7537-02-2
Compound FormulaC4H9NO3
Mass119.05824
Retention Time (min)370.46
SMILESC[C@H](O)[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing Threonine, DL- (3TMS)

       Experimental data on species/experiment(s)