PMR Logo

Member Login   

Methionine, DL- (2TMS)

      Basic compound information

Retention Index0
StdInChIKeyFFEARJCKVFRZRR-SCSAIBSYSA-N
Metabolite annotationMethionine, DL- (2TMS)
ActionCOR_OK:HDA
CAS348-67-4|7005-18-7|27844-10-6|59-51-8|63-68-3
Compound FormulaC5H11NO2S
Mass149.05105
Retention Time (min)408.27
SMILESCSCC[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing Methionine, DL- (2TMS)

       Experimental data on species/experiment(s)