PMR Logo

Member Login   

Threonic acid (4TMS)

      Basic compound information

Retention Index1537.2
StdInChIKeyJPIJQSOTBSSVTP-STHAYSLISA-N
Metabolite annotationThreonic acid (4TMS)
CAS3909-12-4|7306-96-9|38191-88-7|70753-61-6
Compound FormulaC4H8O5
Mass136.03717
Retention Time (min)414.08
SMILESOC[C@H](O)[C@@H](O)C(O)=O

      ChemSpider search

      Pathways containing Threonic acid (4TMS)

       Experimental data on species/experiment(s)