PMR Logo

Member Login   

Phenylalanine, DL- (2TMS)

      Basic compound information

Retention Index1625.6
StdInChIKeyCOLNVLDHVKWLRT-UHFFFAOYSA-N
Metabolite annotationPhenylalanine, DL- (2TMS)
CAS673-06-3|150-30-1|7364-51-4|3617-44-5|2899-42-5|63-91-2|2899-52-7
Compound FormulaC9H11NO2
Mass165.07898
Retention Time (min)435.46
SMILESNC(Cc1ccccc1)C(O)=O

      ChemSpider search

      Pathways containing Phenylalanine, DL- (2TMS)

       Experimental data on species/experiment(s)