PMR Logo

Member Login   

Arabinose, D- (1MEOX) (4TMS)

      Basic compound information

Retention Index1639.4
StdInChIKeyPYMYPHUHKUWMLA-VAYJURFESA-N
Metabolite annotationArabinose, D- (1MEOX) (4TMS)
CAS20235-19-2|147-81-9|5328-37-0|10323-20-3|87-72-9
Compound FormulaC5H10O5
Mass150.05282
Retention Time (min)438.72
SMILES[H]C(=O)[C@H](O)[C@@H](O)[C@@H](O)CO

      ChemSpider search

      Pathways containing Arabinose, D- (1MEOX) (4TMS)

       Experimental data on species/experiment(s)