PMR Logo

Member Login   

Ribose, D- (1MEOX) (4TMS)

      Basic compound information

Retention Index0
StdInChIKeySRBFZHDQGSBBOR-UHFFFAOYSA-N
Metabolite annotationRibose, D- (1MEOX) (4TMS)
ActionCOR_OK:HDA
CAS56196-08-8|50-69-1|6915-40-8
Retention Time (min)442.67
SMILESO[C@H]1CO[C@H](O)[C@@H](O)[C@H]1O

      ChemSpider search

      Pathways containing Ribose, D- (1MEOX) (4TMS)

       Experimental data on species/experiment(s)