PMR Logo

Member Login   

Glutamine, DL- (3TMS)

      Basic compound information

Retention Index1761
StdInChIKeyZDXPYRJPNDTMRX-GSVOUGTGSA-N
Metabolite annotationGlutamine, DL- (3TMS)
CAS5959-95-5|56-85-9|56145-13-2|6899-04-3|585-21-7
Compound FormulaC5H10N2O3
Mass146.06914
Retention Time (min)466.11
SMILESN[C@H](CCC(N)=O)C(O)=O

      ChemSpider search

      Pathways containing Glutamine, DL- (3TMS)

       Experimental data on species/experiment(s)