PMR Logo

Member Login   

Shikimic acid (4TMS)

      Basic compound information

Retention Index1782.9
StdInChIKeyJXOHGGNKMLTUBP-HSUXUTPPSA-N
Metabolite annotationShikimic acid (4TMS)
CAS138-59-0|55520-78-0
Compound FormulaC7H10O5
Mass174.05282
Retention Time (min)470.89
SMILESO[C@@H]1CC(=C[C@@H](O)[C@H]1O)C(O)=O

      ChemSpider search

      Pathways containing Shikimic acid (4TMS)

       Experimental data on species/experiment(s)