PMR Logo

Member Login   

Ornithine, DL- (4TMS)

      Basic compound information

Retention Index0
StdInChIKeyAHLPHDHHMVZTML-SCSAIBSYSA-N
Metabolite annotationOrnithine, DL- (4TMS)
ActionTMS:HI
CAS7006-33-9|24595-70-8|3184-13-2|55556-70-2|70-26-8|348-66-3|616-07-9
Compound FormulaC5H12N2O2
Mass132.08988
Retention Time (min)475.8
SMILESNCCC[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing Ornithine, DL- (4TMS)

       Experimental data on species/experiment(s)