PMR Logo

Member Login   

Mannose, D- (1MEOX) (5TMS)

      Basic compound information

Retention Index1867.1
StdInChIKeyGZCGUPFRVQAUEE-KVTDHHQDSA-N
Metabolite annotationMannose, D- (1MEOX) (5TMS)
CAS10030-80-5|3458-28-4|7296-15-3|530-26-7|31103-86-3
Compound FormulaC6H12O6
Mass180.06339
Retention Time (min)488.58
SMILES[H]C(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO

      ChemSpider search

      Pathways containing Mannose, D- (1MEOX) (5TMS)

       Experimental data on species/experiment(s)