PMR Logo

Member Login   

Tyrosine, L- (3TMS)

      Basic compound information

Retention Index0
StdInChIKeyOUYCCCASQSFEME-MRVPVSSYSA-N
Metabolite annotationTyrosine, L- (3TMS)
ActionCOR_OK:HDA
CAS556-03-6|556-02-5|55520-40-6|51220-73-6|7536-83-6|60-18-4|7415-19-2
Compound FormulaC9H11NO3
Mass181.07389
Retention Time (min)501.5
SMILESN[C@H](Cc1ccc(O)cc1)C(O)=O

      ChemSpider search

      Pathways containing Tyrosine, L- (3TMS)

       Experimental data on species/experiment(s)