PMR Logo

Member Login   

Fructose-6-phosphate (1MEOX) (6TMS)

      Basic compound information

Retention Index0
StdInChIKeyGSXOAOHZAIYLCY-HSUXUTPPSA-N
Metabolite annotationFructose-6-phosphate (1MEOX) (6TMS)
ActionCOR_OK:HDA
CAS643-13-0|55530-74-0|26177-86-6
Compound FormulaC6H13O9P
Mass260.02972
Retention Time (min)565.64
SMILES[H][C@@](O)(COP(O)(O)=O)[C@@]([H])(O)[C@]([H])(O)C(=O)CO

      ChemSpider search

      Pathways containing Fructose-6-phosphate (1MEOX) (6TMS)

       Experimental data on species/experiment(s)