PMR Logo

Member Login   

Cystine, L- (4TMS)

      Basic compound information

Retention Index2281.5
StdInChIKeyLEVWYRKDKASIDU-UHFFFAOYSA-N
Metabolite annotationCystine, L- (4TMS)
CAS69688-44-4|349-46-2|56-89-3|923-32-0|24645-67-8
Compound FormulaC6H12N2O4S2
Mass240.02385
Retention Time (min)566.34
SMILESNC(CSSCC(N)C(O)=O)C(O)=O

      ChemSpider search

      Pathways containing Cystine, L- (4TMS)

       Experimental data on species/experiment(s)