PMR Logo

Member Login   

Glucose-6-phosphate (1MEOX) (6TMS)

      Basic compound information

Retention Index0
StdInChIKeyNBSCHQHZLSJFNQ-GASJEMHNSA-N
Metabolite annotationGlucose-6-phosphate (1MEOX) (6TMS)
ActionCOR_OK:PC1
CAS54010-71-8|299-31-0|56-73-5|55530-73-9|28176-73-0|3671-99-6
Compound FormulaC6H13O9P
Mass260.02972
Retention Time (min)568.3
SMILESOC1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]1O

      ChemSpider search

      Pathways containing Glucose-6-phosphate (1MEOX) (6TMS)

       Experimental data on species/experiment(s)