PMR Logo

Member Login   

Trehalose, alpha,alpha'-, D- (8TMS)

      Basic compound information

Retention Index0
StdInChIKeyHDTRYLNUVZCQOY-LIZSDCNHSA-N
Metabolite annotationTrehalose, alpha,alpha'-, D- (8TMS)
ActionCOR_OK:HDA
CAS6138-23-4|99-20-7
Compound FormulaC12H22O11
Mass342.11621
Retention Time (min)637.98
SMILESOC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

      ChemSpider search

      Pathways containing Trehalose, alpha,alpha'-, D- (8TMS)

       Experimental data on species/experiment(s)