PMR Logo

Member Login   

Sitosterol, beta- (1TMS)

      Basic compound information

Retention Index3391.4
StdInChIKeyKZJWDPNRJALLNS-VJSFXXLFSA-N
Metabolite annotationSitosterol, beta- (1TMS)
CAS5779-62-4|2625-46-9|83-46-5
Compound FormulaC29H50O
Mass414.38617
Retention Time (min)802.26
SMILES[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](CC)C(C)C

      ChemSpider search

      Pathways containing Sitosterol, beta- (1TMS)

       Experimental data on species/experiment(s)