PMR Logo

Member Login   

Succinate

      Basic compound information

Retention Index1300-1311
StdInChIKeyKDYFGRWQOYBRFD-UHFFFAOYSA-L
Metabolite annotationSuccinate
CAS110-15-6|56-14-4|40309-57-7
Compound FormulaC4H6O4
Mass118.02661
Retention Time (min)172;218
SMILES[O-]C(=O)CCC([O-])=O

      ChemSpider search

      Pathways containing Succinate

       Experimental data on species/experiment(s)