PMR Logo

Member Login   

Glutamate

      Basic compound information

Retention Index1604-1611
StdInChIKeyWHUUTDBJXJRKMK-GSVOUGTGSA-N
Metabolite annotationGlutamate
CAS56-86-0|617-65-2|138-16-9|15985-07-6|6893-26-1
Compound FormulaC5H9NO4
Mass147.05316
Retention Time (min)230;246
SMILESN[C@H](CCC(O)=O)C(O)=O

      ChemSpider search

      Pathways containing Glutamate

       Experimental data on species/experiment(s)