PMR Logo

Member Login   

sucrose

      Basic compound information

Retention Index2605-2620
StdInChIKeyCZMRCDWAGMRECN-UGDNZRGBSA-N
Metabolite annotationSucrose
CAS57-50-1|19159-25-2
Compound FormulaC12H22O11
Mass342.11621
Retention Time (min)437;451
SMILESOC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O

      ChemSpider search

      Pathways containing sucrose

       Experimental data on species/experiment(s)