PMR Logo

Member Login   

leucine

      Basic compound information

Retention Index1262-1269
StdInChIKeyROHFNLRQFUQHCH-YFKPBYRVSA-N
Metabolite annotationLeucine
CAS15984-97-1|61-90-5|7364-46-7|7005-03-0|328-38-1|328-39-2
Compound FormulaC6H13NO2
Retention Time (min)158;232
SMILESCC(C)C[C@H](N)C(O)=O

      ChemSpider search

      Pathways containing leucine

       Experimental data on species/experiment(s)