PMR Logo

Member Login   

histidine

      Basic compound information

Retention Index1911-1925
StdInChIKeyHNDVDQJCIGZPNO-YFKPBYRVSA-N
Metabolite annotationHistidine
CAS351-50-8|71-00-1|4998-57-6|17908-25-7|5934-29-2|7006-35-1
Compound FormulaC6H9N3O2
Mass155.06948
Retention Time (min)154;254
SMILESN[C@@H](Cc1c[nH]cn1)C(O)=O

      ChemSpider search

      Pathways containing histidine

       Experimental data on species/experiment(s)