PMR Logo

Member Login   

Aconitate

      Basic compound information

Retention Index1729-1736
StdInChIKeyGTZCVFVGUGFEME-IWQZZHSRSA-N
Metabolite annotationAconitate
Compound FormulaC6H6O6
Retention Time (min)229;285
SMILESC(/C(=C/C(=O)O)/C(=O)O)C(=O)O

      ChemSpider search

      Pathways containing Aconitate

       Experimental data on species/experiment(s)