PMR Logo

Member Login   

Sinapate

      Basic compound information

Retention Index2238-2248
StdInChIKeyPCMORTLOPMLEFB-ONEGZZNKSA-N
Metabolite annotationSinapate
CAS530-59-6|27750-80-7
Compound FormulaC11H12O5
Mass224.06847
Retention Time (min)338;368
SMILESCOc1cc(cc(OC)c1O)\C=C\C(O)=O

      ChemSpider search

      Pathways containing Sinapate

       Experimental data on species/experiment(s)