PMR Logo

Member Login   

3-Cyanoalanine

      Basic compound information

Retention Index1363-1369
StdInChIKeyBXRLWGXPSRYJDZ-VKHMYHEASA-N
Metabolite annotation3-Cyanoalanine
CAS923-01-3|6232-19-5
Compound FormulaC4H6N2O2
Mass114.04293
Retention Time (min)141;243
SMILESN[C@@H](CC#N)C(O)=O

      ChemSpider search

      Pathways containing 3-Cyanoalanine

       Experimental data on species/experiment(s)