PMR Logo

Member Login   

9-Octadecenoic acid

      Basic compound information

StdInChIKeyZQPPMHVWECSIRJ-MDZDMXLPSA-N
Compound FormulaC18H34O2
ISU Metabolite annotationC18:1(9) FA, ME
Retention Time483
SMILESCCCCCCCC/C=C/CCCCCCCC(=O)O
Theoretical Mass282.3

      ChemSpider search

      Pathways containing 9-Octadecenoic acid

       Experimental data on species/experiment(s)