PMR Logo

Member Login   

D-glucose

      Basic compound information

Retention Index263
Metabolite annotationGlucose1
CAS ID50-99-7
Compound FormulaC6H12O6
Exact Mass180.0633881
Mass180.06339
Molecular FormulaC6 H12 O6
Retention Time (min)RT:492-494
SMILESOC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O

      ChemSpider search

      Pathways containing D-glucose

       Experimental data on species/experiment(s)