PMR Logo

Member Login   

L-Leucine

      Basic compound information

Retention Index290
Metabolite annotationLeucine
CAS ID61-90-5
Compound FormulaC6H13NO2
Exact Mass131.0946287
Mass131.09463
Molecular FormulaC6 H13 N1 O2
Retention Time (min)RT:342-344
SMILESCC(C)C[C@H](N)C(O)=O

      ChemSpider search

      Pathways containing L-Leucine

       Experimental data on species/experiment(s)