PMR Logo

Member Login   

L-Phenylalanine

      Basic compound information

Retention Index1626.8
Metabolite annotationPhenylalanine, DL- (2TMS)
CAS ID63-91-2
Compound FormulaC9H11NO2
Exact Mass165.0789786
Mass165.07898
Mass165.1891
Molecular FormulaC9 H11 N1 O2
Retention Time (min)435.56
SMILESNC(Cc1ccccc1)C(O)=O

      ChemSpider search

      Pathways containing L-Phenylalanine

       Experimental data on species/experiment(s)