PMR Logo

Member Login   

L-Threonine

      Basic compound information

Retention Index1373.2
Metabolite annotationThreonine, DL- (3TMS)
CAS ID72-19-5
Compound FormulaC4H9NO3
Exact Mass119.0582432
Mass119
Molecular FormulaC4 H9 N1 O3
Retention Time (min)370.46
SMILESC[C@H](O)[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing L-Threonine

       Experimental data on species/experiment(s)