PMR Logo

Member Login   

L-Valine

      Basic compound information

Retention Index1208.4
Metabolite annotationValine, DL- (2TMS)
CAS ID72-18-4
Compound FormulaC5H11NO2
Exact Mass117.0789786
Mass117.147
Molecular FormulaC5 H11 N1 O2
Retention Time (min)320.46
SMILESCC(C)[C@@H](N)C(O)=O

      ChemSpider search

      Pathways containing L-Valine

       Experimental data on species/experiment(s)