PMR Logo

Member Login   

sitosterol

      Basic compound information

Retention Index3355.4
Retention Index3392.1
StdInChIKeyKZJWDPNRJALLNS-UHFFFAOYSA-N
Metabolite annotationSitosterol
Metabolite annotationSitosterol, beta- (1TMS)
CAS83-46-5
CAS ID83-46-5
Compound FormulaC29H50O
Exact Mass414.3861662
Mass414.386166
Mass414.38617
Metabolite sub-classSTt
Molecular FormulaC29 H50 O1
Molecular formulaC29H50O
Molecular mass (without TMS)414.386166
Retention Time (min)49.8285
Retention Time (min)801.83
SMILES[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](CC)C(C)C
Synonym(-)-beta-Sitosterol
Synonym(24R)24-Ethylcholesta-5,22-dien-3beta-ol
Synonymbeta-sitosterl
SynonymStigmast-5-en-3beta-ol
SynonymStigmasta-5,22-dien-3beta-ol

      ChemSpider search

      Pathways containing sitosterol

       Experimental data on species/experiment(s)