PMR Logo

Member Login   

citric acid

      Basic compound information

Retention Index1799.1
Retention Index1847.4
StdInChIKeyKRKNYBCHXYNGOX-UHFFFAOYSA-N
Metabolite annotationCitric acid
Metabolite annotationCitric acid (4TMS)
CAS ID77-92-9
Compound FormulaC6H8O7
Exact Mass192.0270026
Mass192.027
Mass192.027002
Molecular FormulaC6 H8 O7
Molecular formulaC6H8O7
Molecular mass (without TMS)192.027002
Retention Time (min)26.8885
Retention Time (min)474.28
SMILESOC(=O)CC(O)(CC(O)=O)C(O)=O

      ChemSpider search

      Pathways containing citric acid

       Experimental data on species/experiment(s)