PMR Logo

Member Login   

phytol

      Basic compound information

Retention Index2162.7
StdInChIKeyBOTWFXYSPFMFNR-PYDDKJGSSA-N
Metabolite annotationPhytol
Metabolite annotationPhytol (1TMS)
CAS ID150-86-7
Compound FormulaC20H40O
Exact Mass296.3079159
Mass296
Molecular FormulaC20 H40 O1
Retention Time (min)545.32
SMILESCC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\CO
Synonymtrans-Phytol

      ChemSpider search

      Pathways containing phytol

       Experimental data on species/experiment(s)