PMR Logo

Member Login   

phosphoric acid

      Basic compound information

Retention Index1261.6
StdInChIKeyNBIIXXVUZAFLBC-UHFFFAOYSA-N
Metabolite annotationPhosphoric acid
Metabolite annotationPhosphoric acid (3TMS)
Compound FormulaO4P
Mass97.9769
Retention Time (min)337.33
SMILES[H]OP(=O)(O[H])O[H]

      ChemSpider search

      Pathways containing phosphoric acid

       Experimental data on species/experiment(s)