PMR Logo

Member Login   

succinic acid

      Basic compound information

Retention Index1326.4
Retention Index288
StdInChIKeyKDYFGRWQOYBRFD-UHFFFAOYSA-N
Metabolite annotationButanedioic acid
Metabolite annotationSuccinate
Metabolite annotationSuccinic acid
CAS ID110-15-6
Compound FormulaC4H6O4
Exact Mass118.0266087
Mass118.0266085
Mass118.02661
Molecular FormulaC4 H6 O4
Molecular formulaC4H6O4
Molecular mass (without TMS)118.0266085
Retention Time (min)14.7429
Retention Time (min)RT:351-354
SMILES[O-]C(=O)CCC([O-])=O

      ChemSpider search

      Pathways containing succinic acid

       Experimental data on species/experiment(s)