PMR Logo

Member Login   

galactonic acid

      Basic compound information

Retention Index1978.3
Metabolite annotationgalactonic acid
Metabolite annotationGalactonic acid (6TMS)
Compound FormulaC6H11O7
Mass196
Retention Time (min)510.8
SMILESOC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O

      ChemSpider search

      Pathways containing galactonic acid

       Experimental data on species/experiment(s)